EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20O4 |
| Net Charge | 0 |
| Average Mass | 252.310 |
| Monoisotopic Mass | 252.13616 |
| SMILES | CCCCCc1cc(OC)cc(O)c1C(=O)OC |
| InChI | InChI=1S/C14H20O4/c1-4-5-6-7-10-8-11(17-2)9-12(15)13(10)14(16)18-3/h8-9,15H,4-7H2,1-3H3 |
| InChIKey | SQMVTRKKWFHTDH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pertusaria (ncbitaxon:50932) | - | DOI (10.1007/s10600-020-02936-0) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl 2-hydroxy-4-methoxy-6-pentylbenzoate (CHEBI:214522) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| methyl 2-hydroxy-4-methoxy-6-pentylbenzoate |