EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14N2O3 |
| Net Charge | 0 |
| Average Mass | 258.277 |
| Monoisotopic Mass | 258.10044 |
| SMILES | OCc1cc2c(nc3ccccc32)c([C@@H](O)CO)n1 |
| InChI | InChI=1S/C14H14N2O3/c17-6-8-5-10-9-3-1-2-4-11(9)16-13(10)14(15-8)12(19)7-18/h1-5,12,16-19H,6-7H2/t12-/m0/s1 |
| InChIKey | VAKXHGQDPLEUTH-LBPRGKRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces alboverticillatus (ncbitaxon:173770) | - | PubMed (1150547) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyridindolol (CHEBI:214433) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| 1-[3-(hydroxymethyl)-9H-pyrido[3,4-b]indol-1-yl]ethane-1,2-diol |
| Manual Xrefs | Databases |
|---|---|
| 4513710 | ChemSpider |