EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H55N5O7 |
| Net Charge | 0 |
| Average Mass | 669.864 |
| Monoisotopic Mass | 669.41015 |
| SMILES | CC(C)CC1OC(=O)CCNC(=O)[C@H](C(C)C)N(C)C(=O)[C@H](C(C)C)N(C)C(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H]2[C@@H](C)CCN2C1=O |
| InChI | InChI=1S/C36H55N5O7/c1-21(2)19-27-35(46)41-18-16-24(7)31(41)33(44)38-26(20-25-13-11-10-12-14-25)34(45)40(9)30(23(5)6)36(47)39(8)29(22(3)4)32(43)37-17-15-28(42)48-27/h10-14,21-24,26-27,29-31H,15-20H2,1-9H3,(H,37,43)(H,38,44)/t24-,26-,27?,29-,30-,31-/m0/s1 |
| InChIKey | LQGNIRWAURPTIG-FPKIXTKESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Beauveria felina (ncbitaxon:37994) | - | PubMed (17136888) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Psuedodestruxin C (CHEBI:214413) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (10S,13S,16S,19S,20S)-16-benzyl-11,14,20-trimethyl-3-(2-methylpropyl)-10,13-di(propan-2-yl)-4-oxa-1,8,11,14,17-pentazabicyclo[17.3.0]docosane-2,5,9,12,15,18-hexone |
| Manual Xrefs | Databases |
|---|---|
| 10481538 | ChemSpider |