EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32O2 |
| Net Charge | 0 |
| Average Mass | 316.485 |
| Monoisotopic Mass | 316.24023 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)[C@@H](C(C)=O)CC[C@@]34[H])[C@@]1(C)CCC(=O)C2 |
| InChI | InChI=1S/C21H32O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h14,16-19H,4-12H2,1-3H3/t14-,16-,17+,18-,19-,20-,21+/m0/s1 |
| InChIKey | XMRPGKVKISIQBV-BJMCWZGWSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | progestogen A compound that interacts with progesterone receptors in target tissues to bring about effects similar to those of progesterone. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5α-pregnane-3,20-dione (CHEBI:28952) has functional parent progesterone (CHEBI:17026) |
| 5α-pregnane-3,20-dione (CHEBI:28952) has parent hydride 5α-pregnane (CHEBI:20656) |
| 5α-pregnane-3,20-dione (CHEBI:28952) has role human metabolite (CHEBI:77746) |
| 5α-pregnane-3,20-dione (CHEBI:28952) has role progestogen (CHEBI:50745) |
| 5α-pregnane-3,20-dione (CHEBI:28952) is a 20-oxo steroid (CHEBI:36885) |
| 5α-pregnane-3,20-dione (CHEBI:28952) is a 3-oxo-5α-steroid (CHEBI:13601) |
| 5α-pregnane-3,20-dione (CHEBI:28952) is a C21-steroid hormone (CHEBI:64600) |
| IUPAC Name |
|---|
| 5α-pregnane-3,20-dione |
| Synonyms | Source |
|---|---|
| 3,20-allopregnanedione | ChemIDplus |
| 3,20-dioxo-5α-pregnane | ChemIDplus |
| 5alpha-Dihydroprogesterone | KEGG COMPOUND |
| 5alpha-Pregnane-3,20-dione | KEGG COMPOUND |
| 5-α-dihydroprogesterone | ChemIDplus |
| 5α-dihydroprogesterone | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 5α-pregnane-3,20-dione | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 5%CE%B1-Dihydroprogesterone | Wikipedia |
| C03681 | KEGG COMPOUND |
| HMDB0003759 | HMDB |
| LMST02030170 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2058506 | Reaxys |
| CAS:566-65-4 | ChemIDplus |
| CAS:566-65-4 | KEGG COMPOUND |
| Citations |
|---|