EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O4 |
| Net Charge | 0 |
| Average Mass | 360.494 |
| Monoisotopic Mass | 360.23006 |
| SMILES | C/C=C(\C)[C@H]1[C@@H](/C=C/C=C(\C)C(=O)O)[C@@H]2CC[C@H](C)C[C@H]2C(=O)[C@@]1(C)O |
| InChI | InChI=1S/C22H32O4/c1-6-14(3)19-17(9-7-8-15(4)21(24)25)16-11-10-13(2)12-18(16)20(23)22(19,5)26/h6-9,13,16-19,26H,10-12H2,1-5H3,(H,24,25)/b9-7+,14-6+,15-8+/t13-,16-,17-,18+,19-,22-/m0/s1 |
| InChIKey | GVNQXZBVWDAWQB-CJMDXQGYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicilliumspecies (ncbitaxon:5081) | - | DOI (10.1016/j.tetlet.2015.07.072) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fusarielin I (CHEBI:214329) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E)-5-[(1S,2R,3S,4aR,6S,8aS)-2-[(E)-but-2-en-2-yl]-3-hydroxy-3,6-dimethyl-4-oxo-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-2-methylpenta-2,4-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 40256498 | ChemSpider |