EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18O6 |
| Net Charge | 0 |
| Average Mass | 258.270 |
| Monoisotopic Mass | 258.11034 |
| SMILES | CC1=CC(=O)[C@](O)(CC[C@@H](C)C(=O)O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H18O6/c1-6(11(16)17)3-4-12(18)8(13)5-7(2)9(14)10(12)15/h5-6,9-10,14-15,18H,3-4H2,1-2H3,(H,16,17)/t6-,9-,10-,12-/m1/s1 |
| InChIKey | KBOKFMMFNBVWFW-XYHAGOFUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicilliumspecies F23-2 (ncbitaxon:543960) | - | PubMed (26540093) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penicyclone B (CHEBI:214308) is a hydroxy fatty acid (CHEBI:24654) |
| IUPAC Name |
|---|
| (2R)-2-methyl-4-[(1S,5R,6R)-1,5,6-trihydroxy-4-methyl-2-oxocyclohex-3-en-1-yl]butanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 44210804 | ChemSpider |