EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9NO3 |
| Net Charge | 0 |
| Average Mass | 191.186 |
| Monoisotopic Mass | 191.05824 |
| SMILES | O=C(O)c1cn(CO)c2ccccc12 |
| InChI | InChI=1S/C10H9NO3/c12-6-11-5-8(10(13)14)7-3-1-2-4-9(7)11/h1-5,12H,6H2,(H,13,14) |
| InChIKey | OCSSNZMNGKCKHC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinomadura (ncbitaxon:1988) | - | DOI (10.1016/j.phytol.2013.06.007) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-hydroxymethylindole-3-carboxylic acid (CHEBI:214248) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| 1-(hydroxymethyl)indole-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 45548475 | ChemSpider |