EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H36O8 |
| Net Charge | 0 |
| Average Mass | 488.577 |
| Monoisotopic Mass | 488.24102 |
| SMILES | C=C[C@]1(C)C=C2C(=O)C[C@H]3C(C)(C)CCC[C@]3(C(=O)O[C@@H]3C(=O)C=C(OC)[C@@H](O)[C@H]3O)[C@@]2(O)CC1 |
| InChI | InChI=1S/C27H36O8/c1-6-25(4)10-11-27(33)15(14-25)16(28)13-19-24(2,3)8-7-9-26(19,27)23(32)35-22-17(29)12-18(34-5)20(30)21(22)31/h6,12,14,19-22,30-31,33H,1,7-11,13H2,2-5H3/t19-,20+,21+,22+,25-,26-,27+/m0/s1 |
| InChIKey | NQZUGDCNCPWKMJ-SUNJEODKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Neofusicoccum laricinum (ncbitaxon:121618) | - | PubMed (33069833) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Botrysphin I (CHEBI:214239) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| [(1S,5S,6R)-5,6-dihydroxy-4-methoxy-2-oxocyclohex-3-en-1-yl] (4aR,4bR,7R,10aS)-7-ethenyl-4b-hydroxy-1,1,7-trimethyl-9-oxo-3,4,5,6,10,10a-hexahydro-2H-phenanthrene-4a-carboxylate |