EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18O4 |
| Net Charge | 0 |
| Average Mass | 274.316 |
| Monoisotopic Mass | 274.12051 |
| SMILES | COC(=O)c1cc2c3c(coc3c1)CC[C@@H]2C(C)(C)O |
| InChI | InChI=1S/C16H18O4/c1-16(2,18)12-5-4-9-8-20-13-7-10(15(17)19-3)6-11(12)14(9)13/h6-8,12,18H,4-5H2,1-3H3/t12-/m0/s1 |
| InChIKey | RFNOCSRHGKIMNB-LBPRGKRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trichoderma (ncbitaxon:5543) | - | PubMed (32861754) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trichocadinin L (CHEBI:214148) is a naphthoic acid (CHEBI:25483) |
| IUPAC Name |
|---|
| methyl (7S)-7-(2-hydroxypropan-2-yl)-2-oxatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-10-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 98309182 | ChemSpider |