EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17NO4 |
| Net Charge | 0 |
| Average Mass | 287.315 |
| Monoisotopic Mass | 287.11576 |
| SMILES | O=C(N[C@H](CO)Cc1ccccc1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C16H17NO4/c18-10-13(8-11-4-2-1-3-5-11)17-16(21)12-6-7-14(19)15(20)9-12/h1-7,9,13,18-20H,8,10H2,(H,17,21)/t13-/m0/s1 |
| InChIKey | PJPGHPWWCHJZNR-ZDUSSCGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Retiboletus nigerrimus (ncbitaxon:889443) | - | DOI (10.5560/znb.2013-3050) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nigerrimin A (CHEBI:214114) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| 3,4-dihydroxy-N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]benzamide |
| Manual Xrefs | Databases |
|---|---|
| 51509188 | ChemSpider |