EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O5 |
| Net Charge | 0 |
| Average Mass | 334.412 |
| Monoisotopic Mass | 334.17802 |
| SMILES | C=C1C[C@H](O)[C@H]2C(C)=C(O)C(=O)C[C@]2(C)[C@H]1CC/C(C)=C/C(=O)O |
| InChI | InChI=1S/C19H26O5/c1-10(7-16(22)23)5-6-13-11(2)8-14(20)17-12(3)18(24)15(21)9-19(13,17)4/h7,13-14,17,20,24H,2,5-6,8-9H2,1,3-4H3,(H,22,23)/b10-7+/t13-,14-,17+,19+/m0/s1 |
| InChIKey | LNJOHJISIGCYCQ-LQDUYHBQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (32712131) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penitholabene (CHEBI:214101) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (E)-5-[(1S,4S,4aR,8aR)-4,6-dihydroxy-5,8a-dimethyl-2-methylidene-7-oxo-3,4,4a,8-tetrahydro-1H-naphthalen-1-yl]-3-methylpent-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 98309199 | ChemSpider |