EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H34O7 |
| Net Charge | 0 |
| Average Mass | 458.551 |
| Monoisotopic Mass | 458.23045 |
| SMILES | C=C[C@@]1(C)CC[C@@]23OC[C@@H]4C[C@@H](OC(C)=O)[C@@](C)(COC(=O)C(C)C)C(=C42)C(=O)C(O)=C3C1 |
| InChI | InChI=1S/C26H34O7/c1-7-24(5)8-9-26-17(11-24)21(28)22(29)20-19(26)16(12-32-26)10-18(33-15(4)27)25(20,6)13-31-23(30)14(2)3/h7,14,16,18,28H,1,8-13H2,2-6H3/t16-,18+,24-,25+,26-/m0/s1 |
| InChIKey | QUCYOIDEPYFKBP-CILJJMGQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eutypellaspecies D-1 (ncbitaxon:1689458) | - | PubMed (30115869) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Eutypellenoid C (CHEBI:214074) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| [(1R,4S,10R,11R,13R)-11-acetyloxy-4-ethenyl-7-hydroxy-4,10-dimethyl-8-oxo-15-oxatetracyclo[7.6.1.01,6.013,16]hexadeca-6,9(16)-dien-10-yl]methyl 2-methylpropanoate |
| Manual Xrefs | Databases |
|---|---|
| 78441745 | ChemSpider |