EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20O4 |
| Net Charge | 0 |
| Average Mass | 252.310 |
| Monoisotopic Mass | 252.13616 |
| SMILES | CC(C=C[C@@]1(O)C(C)=C[C@@H](O)C[C@H]1C)=CC(=O)O |
| InChI | InChI=1S/C14H20O4/c1-9(6-13(16)17)4-5-14(18)10(2)7-12(15)8-11(14)3/h4-7,11-12,15,18H,8H2,1-3H3,(H,16,17)/t11-,12-,14-/m1/s1 |
| InChIKey | SNIARLNYOYAXGS-YRGRVCCFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Botrytis cinerea (ncbitaxon:40559) | - | DOI (10.1016/S0031-9422(00)81164-4) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-[(1R,4S,6R)-1,4-dihydroxy-2,6-dimethylcyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid (CHEBI:214055) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 5-[(1R,4S,6R)-1,4-dihydroxy-2,6-dimethylcyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |