EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26O4 |
| Net Charge | 0 |
| Average Mass | 282.380 |
| Monoisotopic Mass | 282.18311 |
| SMILES | CC(=O)[C@@]1(C)CC[C@H](/C(C)=C/[C@H](C)C[C@H](C)C(=O)O)O1 |
| InChI | InChI=1S/C16H26O4/c1-10(9-12(3)15(18)19)8-11(2)14-6-7-16(5,20-14)13(4)17/h8,10,12,14H,6-7,9H2,1-5H3,(H,18,19)/b11-8+/t10-,12-,14+,16+/m0/s1 |
| InChIKey | RQMATXOEBLWDAQ-AXXXBYNLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (32569677) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aspericacid A (CHEBI:214030) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (E,2S,4R)-6-[(2R,5R)-5-acetyl-5-methyloxolan-2-yl]-2,4-dimethylhept-5-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 99740739 | ChemSpider |