EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29NO6 |
| Net Charge | 0 |
| Average Mass | 403.475 |
| Monoisotopic Mass | 403.19949 |
| SMILES | CC(/C=C/C(=O)NC(C(=O)OC(C)C(C)C(=O)O)C(C)c1ccccc1)=C\CO |
| InChI | InChI=1S/C22H29NO6/c1-14(12-13-24)10-11-19(25)23-20(16(3)18-8-6-5-7-9-18)22(28)29-17(4)15(2)21(26)27/h5-12,15-17,20,24H,13H2,1-4H3,(H,23,25)(H,26,27)/b11-10+,14-12+ |
| InChIKey | KFJCKGHURGOYCG-CYZWUHAYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (30065171) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Jomthonic acid E (CHEBI:214029) is a depsipeptide (CHEBI:23643) |
| IUPAC Name |
|---|
| 3-[2-[[(2E,4E)-6-hydroxy-4-methylhexa-2,4-dienoyl]amino]-3-phenylbutanoyl]oxy-2-methylbutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 71048484 | ChemSpider |