EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H37N3O7 |
| Net Charge | 0 |
| Average Mass | 515.607 |
| Monoisotopic Mass | 515.26315 |
| SMILES | C/C=C(C)/C=C/C(=O)NC(C(=O)OC(C)C(C)C(=O)NC(CCC(N)=O)C(=O)O)C(C)c1ccccc1 |
| InChI | InChI=1S/C27H37N3O7/c1-6-16(2)12-15-23(32)30-24(18(4)20-10-8-7-9-11-20)27(36)37-19(5)17(3)25(33)29-21(26(34)35)13-14-22(28)31/h6-12,15,17-19,21,24H,13-14H2,1-5H3,(H2,28,31)(H,29,33)(H,30,32)(H,34,35)/b15-12+,16-6+ |
| InChIKey | JWYOWJRAJBVKBT-NEKUXHKKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (30065171) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Jomthonic acid D (CHEBI:214024) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 5-amino-2-[[2-methyl-3-[2-[[(2E,4E)-4-methylhexa-2,4-dienoyl]amino]-3-phenylbutanoyl]oxybutanoyl]amino]-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 71048485 | ChemSpider |