EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H29NO3 |
| Net Charge | 0 |
| Average Mass | 319.445 |
| Monoisotopic Mass | 319.21474 |
| SMILES | COC(=O)c1ccc(CCCCCCCCCCC(C)=O)cn1 |
| InChI | InChI=1S/C19H29NO3/c1-16(21)11-9-7-5-3-4-6-8-10-12-17-13-14-18(20-15-17)19(22)23-2/h13-15H,3-12H2,1-2H3 |
| InChIKey | UHJLMQFCMOAMFQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicilliumspecies BCC16054 (ncbitaxon:1323390) | - | DOI (10.1016/j.tetlet.2012.11.028) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penicolinate E (CHEBI:213961) is a pyrimidinecarboxylic acid (CHEBI:78574) |
| IUPAC Name |
|---|
| methyl 5-(11-oxododecyl)pyridine-2-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 78434856 | ChemSpider |