EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H22O7 |
| Net Charge | 0 |
| Average Mass | 422.433 |
| Monoisotopic Mass | 422.13655 |
| SMILES | CCCCOC(=O)[C@]1(O)Cc2c3c4c(c(O)ccc4c4ccc(O)c(c24)O1)C(=O)CC3 |
| InChI | InChI=1S/C24H22O7/c1-2-3-10-30-23(28)24(29)11-15-14-5-8-17(26)21-16(25)7-4-12(19(14)21)13-6-9-18(27)22(31-24)20(13)15/h4,6-7,9,25,27,29H,2-3,5,8,10-11H2,1H3/t24-/m0/s1 |
| InChIKey | NAZJNVRQXMZSIG-DEOSSOPVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternaria (ncbitaxon:5598) | - | PubMed (30110969) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Butyl xanalterate (CHEBI:213939) is a phenanthrol (CHEBI:25962) |
| IUPAC Name |
|---|
| butyl 4,7,14-trihydroxy-16-oxo-5-oxapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(19),2(20),6,8,10,12,14-heptaene-4-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 78435274 | ChemSpider |