EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O6 |
| Net Charge | 0 |
| Average Mass | 254.238 |
| Monoisotopic Mass | 254.07904 |
| SMILES | CC(C(=O)O)C(O)COc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C12H14O6/c1-7(11(14)15)10(13)6-18-9-4-2-8(3-5-9)12(16)17/h2-5,7,10,13H,6H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | ZWLHAEAWGFIHEL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sporormiella vexans (ncbitaxon:718248) | - | PubMed (10217738) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sporovexin B (CHEBI:213938) is a benzoic acids (CHEBI:22723) |
| IUPAC Name |
|---|
| 4-(3-carboxy-2-hydroxybutoxy)benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 417690 | ChemSpider |