EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16O4 |
| Net Charge | 0 |
| Average Mass | 320.344 |
| Monoisotopic Mass | 320.10486 |
| SMILES | O=C1CCc2c3c4c(cc(O)cc4c4ccc(O)c1c24)[C@H](O)CC3 |
| InChI | InChI=1S/C20H16O4/c21-9-7-13-12-3-6-17(24)20-16(23)5-2-11(19(12)20)10-1-4-15(22)14(8-9)18(10)13/h3,6-8,15,21-22,24H,1-2,4-5H2/t15-/m1/s1 |
| InChIKey | QGJYUNNYYGGAKL-OAHLLOKOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternaria (ncbitaxon:5598) | |||
| - | PubMed (30110969) | ||
| - | PubMed (32827694) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Altertoxin VII (CHEBI:213933) is a phenanthrol (CHEBI:25962) |
| IUPAC Names |
|---|
| (10R)-4,8,10-trihydroxy-2,10,11,12-tetrahydro-1H-perylen-3-one |
| (1S,2S)-1,2,4,9-tetrahydroxy-1,2,11,12-tetrahydroperylene-3,10-dione |
| Manual Xrefs | Databases |
|---|---|
| 71044380 | ChemSpider |