EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H18N4O5 |
| Net Charge | 0 |
| Average Mass | 406.398 |
| Monoisotopic Mass | 406.12772 |
| SMILES | C[C@@H]1NC(=O)[C@@H]([N+](=O)[O-])Cc2cn(c3ccccc23)C(=O)c2ccccc2NC1=O |
| InChI | InChI=1S/C21H18N4O5/c1-12-19(26)23-16-8-4-2-7-15(16)21(28)24-11-13(14-6-3-5-9-17(14)24)10-18(25(29)30)20(27)22-12/h2-9,11-12,18H,10H2,1H3,(H,22,27)(H,23,26)/t12-,18-/m0/s1 |
| InChIKey | BGXUVIBODLPBMB-SGTLLEGYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicilliumspecies YT-2016 (ncbitaxon:1813945) | - | PubMed (15568799) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Psychrophilin C (CHEBI:213904) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (11S,14S)-11-methyl-14-nitro-1,9,12-triazatetracyclo[14.6.1.03,8.017,22]tricosa-3,5,7,16(23),17,19,21-heptaene-2,10,13-trione |
| Manual Xrefs | Databases |
|---|---|
| 9581992 | ChemSpider |