EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H64N6O6 |
| Net Charge | 0 |
| Average Mass | 676.944 |
| Monoisotopic Mass | 676.48873 |
| SMILES | C#CCCCC[C@@H](C)C(=O)N(C)[C@H](C(=O)N[C@@H](C(=O)N[C@H](C(=O)N(C)[C@H](C(=O)N[C@@H](C)C(N)=O)[C@H](C)CC)[C@H](C)CC)C(C)C)C(C)C |
| InChI | InChI=1S/C36H64N6O6/c1-14-17-18-19-20-25(10)35(47)41(12)29(22(6)7)33(45)39-27(21(4)5)32(44)40-28(23(8)15-2)36(48)42(13)30(24(9)16-3)34(46)38-26(11)31(37)43/h1,21-30H,15-20H2,2-13H3,(H2,37,43)(H,38,46)(H,39,45)(H,40,44)/t23-,24-,25-,26+,27-,28+,29+,30+/m1/s1 |
| InChIKey | KQSQXKSUNVGZND-VEPIHAAWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oscillatoria nigro-viridis (ncbitaxon:482564) | - | PubMed (25468043) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Almiramide E (CHEBI:213878) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2R)-N-[(2S)-1-[[(2R)-1-[[(2S,3R)-1-[[(2S,3R)-1-[[(2S)-1-amino-1-oxopropan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]-methylamino]-3-methyl-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-N,2-dimethyloct-7-ynamide |