EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20N2O3S |
| Net Charge | 0 |
| Average Mass | 308.403 |
| Monoisotopic Mass | 308.11946 |
| SMILES | CCCC1=C/C(=C/SC(=O)[C@@H](C)NC(C)=O)NC(=O)C=C1 |
| InChI | InChI=1S/C15H20N2O3S/c1-4-5-12-6-7-14(19)17-13(8-12)9-21-15(20)10(2)16-11(3)18/h6-10H,4-5H2,1-3H3,(H,16,18)(H,17,19)/b13-9-/t10-/m1/s1 |
| InChIKey | MNXQILGAFRKSSF-PEHNMLCRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas (ncbitaxon:286) | - | PubMed (32194170) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Monathioamide A (CHEBI:213868) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| S-[(Z)-(7-oxo-4-propylazepin-2-ylidene)methyl] (2R)-2-acetamidopropanethioate |
| Manual Xrefs | Databases |
|---|---|
| 97510526 | ChemSpider |