EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H51ClN4O7 |
| Net Charge | 0 |
| Average Mass | 639.234 |
| Monoisotopic Mass | 638.34463 |
| SMILES | CN[C@@H](CCCCCCCCl)[C@H](O)C(=O)N[C@H](Cc1ccc(O)cc1)C(=O)N(C)[C@@H](CC(C)C)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C32H51ClN4O7/c1-21(2)19-27(31(42)37-18-10-12-26(37)32(43)44)36(4)30(41)25(20-22-13-15-23(38)16-14-22)35-29(40)28(39)24(34-3)11-8-6-5-7-9-17-33/h13-16,21,24-28,34,38-39H,5-12,17-20H2,1-4H3,(H,35,40)(H,43,44)/t24-,25+,26-,27-,28-/m0/s1 |
| InChIKey | XKHYSDRFYVFNEQ-IXSXPGEMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microcystisspecies (ncbitaxon:1127) | - | PubMed (29498640) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Microginin KR638 (CHEBI:213860) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-1-[(2S)-2-[[(2R)-2-[[(2S,3S)-10-chloro-2-hydroxy-3-(methylamino)decanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]-methylamino]-4-methylpentanoyl]pyrrolidine-2-carboxylic acid |