EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H52N4O7 |
| Net Charge | 0 |
| Average Mass | 604.789 |
| Monoisotopic Mass | 604.38360 |
| SMILES | CCCCCCC[C@H](NC)[C@H](O)C(=O)N[C@H](Cc1ccc(O)cc1)C(=O)N(C)[C@@H](CC(C)C)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C32H52N4O7/c1-6-7-8-9-10-12-24(33-4)28(38)29(39)34-25(20-22-14-16-23(37)17-15-22)30(40)35(5)27(19-21(2)3)31(41)36-18-11-13-26(36)32(42)43/h14-17,21,24-28,33,37-38H,6-13,18-20H2,1-5H3,(H,34,39)(H,42,43)/t24-,25+,26-,27-,28-/m0/s1 |
| InChIKey | GPDYVBKEQKRQEM-IXSXPGEMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microcystisspecies (ncbitaxon:1127) | - | PubMed (29498640) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Microginin KR604 (CHEBI:213856) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-1-[(2S)-2-[[(2R)-2-[[(2S,3S)-2-hydroxy-3-(methylamino)decanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]-methylamino]-4-methylpentanoyl]pyrrolidine-2-carboxylic acid |