EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H53N5O10 |
| Net Charge | 0 |
| Average Mass | 727.856 |
| Monoisotopic Mass | 727.37924 |
| SMILES | CCCCCCC[C@H](N)[C@@H](O)C(=O)N[C@@H](C(=O)N1CCC[C@@H]1C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](Cc1ccc(O)cc1)C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C37H53N5O10/c1-3-4-5-6-7-9-27(38)32(46)35(49)41-31(22(2)43)36(50)42-19-8-10-30(42)34(48)39-28(20-23-11-15-25(44)16-12-23)33(47)40-29(37(51)52)21-24-13-17-26(45)18-14-24/h11-18,22,27-32,43-46H,3-10,19-21,38H2,1-2H3,(H,39,48)(H,40,47)(H,41,49)(H,51,52)/t22-,27+,28+,29-,30-,31-,32-/m1/s1 |
| InChIKey | MQLHZIBESRENLM-WPTGQUBASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microcystisspecies (ncbitaxon:1127) | - | PubMed (29498640) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Microginin FR3 (CHEBI:213848) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2R)-2-[[(2S)-2-[[(2R)-1-[(2R,3R)-2-[[(2R,3S)-3-amino-2-hydroxydecanoyl]amino]-3-hydroxybutanoyl]pyrrolidine-2-carbonyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |