EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O6 |
| Net Charge | 0 |
| Average Mass | 240.211 |
| Monoisotopic Mass | 240.06339 |
| SMILES | COc1c(O)c(C)c2c(c1O)C(=O)O[C@@H]2OC |
| InChI | InChI=1S/C11H12O6/c1-4-5-6(10(14)17-11(5)16-3)8(13)9(15-2)7(4)12/h11-13H,1-3H3/t11-/m0/s1 |
| InChIKey | RXLDDBZBOMRQLI-NSHDSACASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus versicolor (ncbitaxon:46472) | - | PubMed (32151636) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Versicobenzo A (CHEBI:213826) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-3,6-dimethoxy-4-methyl-3H-2-benzouran-1-one |