EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H60ClN5O9 |
| Net Charge | 0 |
| Average Mass | 802.410 |
| Monoisotopic Mass | 801.40796 |
| SMILES | CN[C@@H](CCCCCCCCl)[C@H](O)C(=O)N[C@H](Cc1ccc(O)cc1)C(=O)N(C)[C@@H](CC(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C41H60ClN5O9/c1-26(2)23-35(40(54)47-22-10-12-34(47)37(51)45-33(41(55)56)25-28-15-19-30(49)20-16-28)46(4)39(53)32(24-27-13-17-29(48)18-14-27)44-38(52)36(50)31(43-3)11-8-6-5-7-9-21-42/h13-20,26,31-36,43,48-50H,5-12,21-25H2,1-4H3,(H,44,52)(H,45,51)(H,55,56)/t31-,32+,33+,34-,35-,36-/m0/s1 |
| InChIKey | JVWJLDYSLLPVBU-VBBYNRSSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microcystisspecies (ncbitaxon:1127) | - | PubMed (29498640) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Microginin KR801 (CHEBI:213818) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2R)-2-[[(2S)-1-[(2S)-2-[[(2R)-2-[[(2S,3S)-10-chloro-2-hydroxy-3-(methylamino)decanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]-methylamino]-4-methylpentanoyl]pyrrolidine-2-carbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid |