EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H62ClN5O9 |
| Net Charge | 0 |
| Average Mass | 816.437 |
| Monoisotopic Mass | 815.42361 |
| SMILES | CN[C@H](CCCCCCCCl)[C@@H](O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N(C)[C@@H](CC(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)OC |
| InChI | InChI=1S/C42H62ClN5O9/c1-27(2)24-36(41(55)48-23-11-13-35(48)38(52)46-34(42(56)57-5)26-29-16-20-31(50)21-17-29)47(4)40(54)33(25-28-14-18-30(49)19-15-28)45-39(53)37(51)32(44-3)12-9-7-6-8-10-22-43/h14-21,27,32-37,44,49-51H,6-13,22-26H2,1-5H3,(H,45,53)(H,46,52)/t32-,33+,34+,35+,36+,37-/m1/s1 |
| InChIKey | BCSACAJIXMDUHU-OBWIRWOGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microcystisspecies (ncbitaxon:1127) | - | PubMed (29498640) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Microginin KR815 (CHEBI:213807) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| methyl (2S)-2-[[(2S)-1-[(2S)-2-[[(2S)-2-[[(2R,3R)-10-chloro-2-hydroxy-3-(methylamino)decanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]-methylamino]-4-methylpentanoyl]pyrrolidine-2-carbonyl]amino]-3-(4-hydroxyphenyl)propanoate |