EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H63N5O9 |
| Net Charge | 0 |
| Average Mass | 781.992 |
| Monoisotopic Mass | 781.46258 |
| SMILES | CCCCCCC[C@@H](NC)[C@@H](O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N(C)[C@@H](CC(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)OC |
| InChI | InChI=1S/C42H63N5O9/c1-7-8-9-10-11-13-32(43-4)37(50)39(52)44-33(25-28-15-19-30(48)20-16-28)40(53)46(5)36(24-27(2)3)41(54)47-23-12-14-35(47)38(51)45-34(42(55)56-6)26-29-17-21-31(49)22-18-29/h15-22,27,32-37,43,48-50H,7-14,23-26H2,1-6H3,(H,44,52)(H,45,51)/t32-,33+,34+,35+,36+,37-/m1/s1 |
| InChIKey | FSQHYAPXIVZVRY-OBWIRWOGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microcystisspecies (ncbitaxon:1127) | - | PubMed (29498640) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Microginin KR781 (CHEBI:213801) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| methyl (2S)-2-[[(2S)-1-[(2S)-2-[[(2S)-2-[[(2R,3R)-2-hydroxy-3-(methylamino)decanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]-methylamino]-4-methylpentanoyl]pyrrolidine-2-carbonyl]amino]-3-(4-hydroxyphenyl)propanoate |