EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H40N4O6 |
| Net Charge | 0 |
| Average Mass | 492.617 |
| Monoisotopic Mass | 492.29478 |
| SMILES | CC[C@H](O)[C@H](Cc1ccccc1)NC(=O)[C@@H]1CCCNN1C(=O)[C@H](NC(=O)COC)[C@H](O)C(C)C |
| InChI | InChI=1S/C25H40N4O6/c1-5-20(30)18(14-17-10-7-6-8-11-17)27-24(33)19-12-9-13-26-29(19)25(34)22(23(32)16(2)3)28-21(31)15-35-4/h6-8,10-11,16,18-20,22-23,26,30,32H,5,9,12-15H2,1-4H3,(H,27,33)(H,28,31)/t18-,19-,20-,22+,23+/m0/s1 |
| InChIKey | DPENGEYUBPGRBN-GHIJRLNRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (21857753) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Actinoramide C (CHEBI:213798) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (3S)-2-[(2R,3R)-3-hydroxy-2-[(2-methoxyacetyl)amino]-4-methylpentanoyl]-N-[(2S,3S)-3-hydroxy-1-phenylpentan-2-yl]diazinane-3-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 28288933 | ChemSpider |