EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21NO5 |
| Net Charge | 0 |
| Average Mass | 367.401 |
| Monoisotopic Mass | 367.14197 |
| SMILES | C[C@@H](C(=O)O)C1Cc2c(cc3c(c2O)CN(CCc2ccccc2)C3=O)O1 |
| InChI | InChI=1S/C21H21NO5/c1-12(21(25)26)17-10-15-18(27-17)9-14-16(19(15)23)11-22(20(14)24)8-7-13-5-3-2-4-6-13/h2-6,9,12,17,23H,7-8,10-11H2,1H3,(H,25,26)/t12-,17?/m1/s1 |
| InChIKey | DRHXVHUEEOCNMZ-MTATWXBHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Crucibulum (ncbitaxon:68774) | - | DOI (10.1002/(sici)1521-4028(199912)39:5/6<357::aid-jobm357>3.0.co;2-8) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Salfredin 8 (CHEBI:213765) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| (2R)-2-[4-hydroxy-7-oxo-6-(2-phenylethyl)-3,5-dihydro-2H-uro[2,3-]isoindol-2-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78442779 | ChemSpider |