EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H31NO6 |
| Net Charge | 0 |
| Average Mass | 393.480 |
| Monoisotopic Mass | 393.21514 |
| SMILES | CC(=O)OCCCCCCC/C=C/C(=O)N[C@H](CO)Cc1cc(O)ccc1O |
| InChI | InChI=1S/C21H31NO6/c1-16(24)28-12-8-6-4-2-3-5-7-9-21(27)22-18(15-23)13-17-14-19(25)10-11-20(17)26/h7,9-11,14,18,23,25-26H,2-6,8,12-13,15H2,1H3,(H,22,27)/b9-7+/t18-/m0/s1 |
| InChIKey | DSNBAJFZYXGEIW-KOEDOTQGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordycepsspecies (ncbitaxon:1755423) | - | PubMed (32092531) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cordycepamide D (CHEBI:213748) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| [(E)-10-[[(2S)-1-(2,5-dihydroxyphenyl)-3-hydroxypropan-2-yl]amino]-10-oxodec-8-enyl] acetate |