EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:213742 - Cordycepamide C
| Formula | C19H27NO5 |
| Net Charge | 0 |
| Average Mass | 349.427 |
| Monoisotopic Mass | 349.18892 |
| SMILES | CC(=O)OCCCCC/C=C/C(=O)N[C@H](CO)Cc1ccccc1O |
| InChI | InChI=1S/C19H27NO5/c1-15(22)25-12-8-4-2-3-5-11-19(24)20-17(14-21)13-16-9-6-7-10-18(16)23/h5-7,9-11,17,21,23H,2-4,8,12-14H2,1H3,(H,20,24)/b11-5+/t17-/m0/s1 |
| InChIKey | QOTCMMPKMPAFBW-RIWGIVCCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordycepsspecies (ncbitaxon:1755423) | - | PubMed (32092531) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cordycepamide C (CHEBI:213742) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| [(E)-8-[[(2S)-1-hydroxy-3-(2-hydroxyphenyl)propan-2-yl]amino]-8-oxooct-6-enyl] acetate |