EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14O3 |
| Net Charge | 0 |
| Average Mass | 170.208 |
| Monoisotopic Mass | 170.09429 |
| SMILES | C/C=C/[C@H](O)[C@@H](C)/C=C/C(=O)O |
| InChI | InChI=1S/C9H14O3/c1-3-4-8(10)7(2)5-6-9(11)12/h3-8,10H,1-2H3,(H,11,12)/b4-3+,6-5+/t7-,8-/m0/s1 |
| InChIKey | PZWFKAARULQPBT-DPDRAWFQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gliomastixspecies ZSDS1-F7-2 (ncbitaxon:1777006) | - | PubMed (29987219) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gliomacid A (CHEBI:213728) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4S,5S,6E)-5-hydroxy-4-methylocta-2,6-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 71048511 | ChemSpider |