EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H45N3O6S |
| Net Charge | 0 |
| Average Mass | 515.717 |
| Monoisotopic Mass | 515.30291 |
| SMILES | CCCCCC(=O)N[C@H](C(=O)N[C@@H](CCS(C)=O)C(=O)N[C@@H](CC(C)C)C(=O)[C@@]1(C)CO1)C(C)C |
| InChI | InChI=1S/C25H45N3O6S/c1-8-9-10-11-20(29)28-21(17(4)5)24(32)26-18(12-13-35(7)33)23(31)27-19(14-16(2)3)22(30)25(6)15-34-25/h16-19,21H,8-15H2,1-7H3,(H,26,32)(H,27,31)(H,28,29)/t18-,19-,21-,25+,35?/m0/s1 |
| InChIKey | KLYPRXGLYCCNGZ-PFIKXURKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Symploca (ncbitaxon:105591) | - | PubMed (22383253) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Carmaphycin A (CHEBI:213693) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| N-[(2S)-3-methyl-1-[[(2S)-1-[[(2S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]-1-oxopentan-2-yl]amino]-4-methylsulinyl-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl]hexanamide |
| Manual Xrefs | Databases |
|---|---|
| 29214692 | ChemSpider |