EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H39N7O10 |
| Net Charge | 0 |
| Average Mass | 561.593 |
| Monoisotopic Mass | 561.27584 |
| SMILES | CN[C@@H](CCCN(O)C=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN(O)C=O)C(=O)N(C)[C@H]1CCCN(O)C1=O |
| InChI | InChI=1S/C22H39N7O10/c1-23-15(6-3-9-27(37)13-31)19(33)25-17(12-30)20(34)24-16(7-4-10-28(38)14-32)21(35)26(2)18-8-5-11-29(39)22(18)36/h13-18,23,30,37-39H,3-12H2,1-2H3,(H,24,34)(H,25,33)/t15-,16-,17-,18-/m0/s1 |
| InChIKey | VJIWUTHTOFWQLT-XSLAGTTESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Amycolatopsis (ncbitaxon:1813) | - | PubMed (29875351) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Albisporachelin (CHEBI:213684) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-5-[ormyl(hydroxy)amino]-N-[(2S)-1-[[(2S)-5-[ormyl(hydroxy)amino]-1-[[(3S)-1-hydroxy-2-oxopiperidin-3-yl]-methylamino]-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]-2-(methylamino)pentanamide |
| Manual Xrefs | Databases |
|---|---|
| 71044416 | ChemSpider |