EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO4S |
| Net Charge | 0 |
| Average Mass | 181.213 |
| Monoisotopic Mass | 181.04088 |
| SMILES | CS(=O)(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H11NO4S/c1-11(9,10)3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1 |
| InChIKey | UCUNFLYVYCGDHP-BYPYZUCNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombyx mori (ncbitaxon:7091) | - | PubMed (18071251) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-methionine sulfone (CHEBI:21363) has role animal metabolite (CHEBI:75767) |
| L-methionine sulfone (CHEBI:21363) is a L-methionine derivative (CHEBI:84121) |
| L-methionine sulfone (CHEBI:21363) is a methionine sulfone (CHEBI:132188) |
| L-methionine sulfone (CHEBI:21363) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-methionine sulfone (CHEBI:21363) is tautomer of methionine sulfone zwitterion (CHEBI:87824) |
| Incoming Relation(s) |
| L-methionine sulfone residue (CHEBI:156065) is substituent group from L-methionine sulfone (CHEBI:21363) |
| methionine sulfone zwitterion (CHEBI:87824) is tautomer of L-methionine sulfone (CHEBI:21363) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-(methylsulfonyl)butanoic acid |
| Synonyms | Source |
|---|---|
| (S)-Amino-4-(methylsulphonyl)butyric acid | ChemIDplus |
| methionine sulfone | ChEBI |
| S-DIOXYMETHIONINE | PDBeChem |
| L-2-amino-4-(methylsulfonyl)butanoic acid | ChEBI |
| L-methionine sulfone | ChEBI |
| Citations |
|---|