EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18N2O2 |
| Net Charge | 0 |
| Average Mass | 318.376 |
| Monoisotopic Mass | 318.13683 |
| SMILES | O=C(Cc1cnc2ccccc12)OCCc1cnc2ccccc12 |
| InChI | InChI=1S/C20H18N2O2/c23-20(11-15-13-22-19-8-4-2-6-17(15)19)24-10-9-14-12-21-18-7-3-1-5-16(14)18/h1-8,12-13,21-22H,9-11H2 |
| InChIKey | QQJHMUZTCXCFCF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Colletotrichum (ncbitaxon:5455) | - | PubMed (31870947) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Colletotryptin F (CHEBI:213617) is a indole-3-acetic acids (CHEBI:24803) |
| IUPAC Name |
|---|
| 2-(1H-indol-3-yl)ethyl 2-(1H-indol-3-yl)acetate |
| Manual Xrefs | Databases |
|---|---|
| 81369104 | ChemSpider |