EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H55N5O9 |
| Net Charge | 0 |
| Average Mass | 713.873 |
| Monoisotopic Mass | 713.39998 |
| SMILES | CCCCCCCC(N)C(O)C(=O)N[C@@H](C)C(=O)N[C@H](C(=O)N(C)[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O)C(C)C |
| InChI | InChI=1S/C37H55N5O9/c1-6-7-8-9-10-11-28(38)32(45)35(48)39-23(4)33(46)41-31(22(2)3)36(49)42(5)30(21-25-14-18-27(44)19-15-25)34(47)40-29(37(50)51)20-24-12-16-26(43)17-13-24/h12-19,22-23,28-32,43-45H,6-11,20-21,38H2,1-5H3,(H,39,48)(H,40,47)(H,41,46)(H,50,51)/t23-,28?,29-,30-,31-,32?/m0/s1 |
| InChIKey | KPCUJSJUCHBAJR-UIDDANAXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microcystis aeruginosa (ncbitaxon:1126) | - | DOI (10.1016/0040-4039(93)85112-a) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Microginin (CHEBI:213598) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[(3-amino-2-hydroxydecanoyl)amino]propanoyl]amino]-3-methylbutanoyl]-methylamino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78438039 | ChemSpider |