EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O8 |
| Net Charge | 0 |
| Average Mass | 210.138 |
| Monoisotopic Mass | 210.03757 |
| SMILES | O=C(O)[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)C(=O)O |
| WURCS | WURCS=2.0/1,1,0/[A2211A]/1/ |
| InChI | InChI=1S/C6H10O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,7-10H,(H,11,12)(H,13,14)/t1-,2-,3-,4-/m1/s1 |
| InChIKey | DSLZVSRJTYRBFB-ZNIBRBMXSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-mannaric acid (CHEBI:21359) is a mannaric acid (CHEBI:25161) |
| L-mannaric acid (CHEBI:21359) is conjugate acid of L-mannarate(1−) (CHEBI:21358) |
| L-mannaric acid (CHEBI:21359) is enantiomer of D-mannaric acid (CHEBI:21049) |
| Incoming Relation(s) |
| L-mannarate(1−) (CHEBI:21358) is conjugate base of L-mannaric acid (CHEBI:21359) |
| D-mannaric acid (CHEBI:21049) is enantiomer of L-mannaric acid (CHEBI:21359) |
| IUPAC Name |
|---|
| L-mannaric acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1728121 | Reaxys |