EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H42N6O7 |
| Net Charge | 0 |
| Average Mass | 598.701 |
| Monoisotopic Mass | 598.31150 |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](CCc1ccc(O)cc1)NC(=O)C(O)Cc1ccc(O)cc1)C(=O)NC(C=O)CCCN=C(N)N |
| InChI | InChI=1S/C30H42N6O7/c1-18(2)26(29(43)34-21(17-37)4-3-15-33-30(31)32)36-27(41)24(14-9-19-5-10-22(38)11-6-19)35-28(42)25(40)16-20-7-12-23(39)13-8-20/h5-8,10-13,17-18,21,24-26,38-40H,3-4,9,14-16H2,1-2H3,(H,34,43)(H,35,42)(H,36,41)(H4,31,32,33)/t21?,24-,25?,26+/m1/s1 |
| InChIKey | ZSCHPQBYWNYITD-RWLGUYTISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nostocspecies CENA543 (ncbitaxon:1869241) | - | PubMed (29062311) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pseudospumigin C (CHEBI:213560) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]-2-[[(2R)-2-[[2-hydroxy-3-(4-hydroxyphenyl)propanoyl]amino]-4-(4-hydroxyphenyl)butanoyl]amino]-3-methylbutanamide |