EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H10N2O2 |
| Net Charge | 0 |
| Average Mass | 118.136 |
| Monoisotopic Mass | 118.07423 |
| SMILES | NCCNCC(=O)O |
| InChI | InChI=1S/C4H10N2O2/c5-1-2-6-3-4(7)8/h6H,1-3,5H2,(H,7,8) |
| InChIKey | PIINGYXNCHTJTF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyanobacterium (ncbitaxon:102234) | - | PubMed (23145061) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(2-aminoethyl)-glycine (CHEBI:213462) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-(2-aminoethylamino)acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 379422 | ChemSpider |