EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O6 |
| Net Charge | 0 |
| Average Mass | 288.255 |
| Monoisotopic Mass | 288.06339 |
| SMILES | COc1cc(O)c2c(c1)C(=O)C1=C(C2=O)[C@@H](O)OC(C)=C1 |
| InChI | InChI=1S/C15H12O6/c1-6-3-8-12(15(19)21-6)14(18)11-9(13(8)17)4-7(20-2)5-10(11)16/h3-5,15-16,19H,1-2H3/t15-/m0/s1 |
| InChIKey | GFWTXOGXHJBKBI-HNNXBMFYSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ascomycone B (CHEBI:213435) is a benzoisochromanequinone (CHEBI:48129) |
| IUPAC Name |
|---|
| 1,9-dihydroxy-7-methoxy-3-methyl-1H-benzo[g]isochromene-5,10-dione |
| Manual Xrefs | Databases |
|---|---|
| 24635627 | ChemSpider |