EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H61N5O9 |
| Net Charge | 0 |
| Average Mass | 755.954 |
| Monoisotopic Mass | 755.44693 |
| SMILES | CCCCCCCC(N)C(O)C(=O)NC(C(=O)NC(CC(C)C)C(=O)NC(CCc1ccc(O)cc1)C(=O)NC(Cc1ccc(O)cc1)C(=O)O)C(C)C |
| InChI | InChI=1S/C40H61N5O9/c1-6-7-8-9-10-11-30(41)35(48)39(52)45-34(25(4)5)38(51)43-32(22-24(2)3)37(50)42-31(21-16-26-12-17-28(46)18-13-26)36(49)44-33(40(53)54)23-27-14-19-29(47)20-15-27/h12-15,17-20,24-25,30-35,46-48H,6-11,16,21-23,41H2,1-5H3,(H,42,50)(H,43,51)(H,44,49)(H,45,52)(H,53,54) |
| InChIKey | IFKUPHYTIDOPIM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microcystisspecies (ncbitaxon:1127) | - | PubMed (22757607) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Microginin 756 (CHEBI:213394) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-[[2-[[2-[[2-[(3-amino-2-hydroxydecanoyl)amino]-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]-4-(4-hydroxyphenyl)butanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |