EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30N2O6 |
| Net Charge | 0 |
| Average Mass | 466.534 |
| Monoisotopic Mass | 466.21039 |
| SMILES | C=CC(C)(C)[C@@]1(C[C@@H](NC(=O)[C@@H](O)Cc2ccccc2)C(=O)OC)C(=O)Nc2c(O)cccc21 |
| InChI | InChI=1S/C26H30N2O6/c1-5-25(2,3)26(17-12-9-13-19(29)21(17)28-24(26)33)15-18(23(32)34-4)27-22(31)20(30)14-16-10-7-6-8-11-16/h5-13,18,20,29-30H,1,14-15H2,2-4H3,(H,27,31)(H,28,33)/t18-,20+,26-/m1/s1 |
| InChIKey | NLJQJJGYCFVOFQ-ZTEVPRNISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (29614724) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-epi-seco-shornephine a methyl ester (CHEBI:213368) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| methyl (2R)-3-[(3R)-7-hydroxy-3-(2-methylbut-3-en-2-yl)-2-oxo-1H-indol-3-yl]-2-[[(2S)-2-hydroxy-3-phenylpropanoyl]amino]propanoate |