EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H46N2O9 |
| Net Charge | 0 |
| Average Mass | 614.736 |
| Monoisotopic Mass | 614.32033 |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/C(C(=O)NC(Cc1cnc2ccccc12)C(=O)O)C(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C33H46N2O9/c1-2-3-4-7-10-15-24(36)16-11-8-5-6-9-12-18-26(33(44,32(42)43)21-29(37)38)30(39)35-28(31(40)41)20-23-22-34-27-19-14-13-17-25(23)27/h12-14,17-19,22,26,28,34,44H,2-11,15-16,20-21H2,1H3,(H,35,39)(H,37,38)(H,40,41)(H,42,43)/b18-12+ |
| InChIKey | KXOCQGQADUMFQO-LDADJPATSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trichoderma viride (ncbitaxon:5547) | - | DOI (10.1016/s0040-4039(00)73961-x) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Viridiofungin C (CHEBI:213329) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-[(E)-1-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 8027652 | ChemSpider |