EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H31NO6 |
| Net Charge | 0 |
| Average Mass | 393.480 |
| Monoisotopic Mass | 393.21514 |
| SMILES | CC(=O)O[C@@H](C)/C=C\C(=O)N[C@@H]1C[C@H](C)[C@H](C/C=C(C)/C=C/C(=O)O)O[C@@H]1C |
| InChI | InChI=1S/C21H31NO6/c1-13(7-11-21(25)26)6-9-19-14(2)12-18(16(4)28-19)22-20(24)10-8-15(3)27-17(5)23/h6-8,10-11,14-16,18-19H,9,12H2,1-5H3,(H,22,24)(H,25,26)/b10-8-,11-7+,13-6+/t14-,15-,16+,18+,19-/m0/s1 |
| InChIKey | SPJBXWLUCQGFSA-OGGYWXJKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Burkholderiaspecies FERM BP-3421 (ncbitaxon:1494466) | - | PubMed (25098528) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Spliceostatin G (CHEBI:213322) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E)-6-[(2S,3S,5R,6R)-5-[[(Z,4S)-4-acetyloxypent-2-enoyl]amino]-3,6-dimethyloxan-2-yl]-4-methylhexa-2,4-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 58112411 | ChemSpider |