EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O8 |
| Net Charge | -2 |
| Average Mass | 208.122 |
| Monoisotopic Mass | 208.02301 |
| SMILES | O=C([O-])[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)[O-] |
| InChI | InChI=1S/C6H10O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,7-10H,(H,11,12)(H,13,14)/p-2/t1-,2-,3+,4+/m0/s1 |
| InChIKey | DSLZVSRJTYRBFB-ORZLYADOSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-idarate(2−) (CHEBI:21332) is a idarate(2−) (CHEBI:35385) |
| L-idarate(2−) (CHEBI:21332) is conjugate base of L-idarate(1−) (CHEBI:35387) |
| L-idarate(2−) (CHEBI:21332) is enantiomer of D-idarate(2−) (CHEBI:21040) |
| Incoming Relation(s) |
| L-idarate(1−) (CHEBI:35387) is conjugate acid of L-idarate(2−) (CHEBI:21332) |
| D-idarate(2−) (CHEBI:21040) is enantiomer of L-idarate(2−) (CHEBI:21332) |
| IUPAC Name |
|---|
| L-idarate |
| UniProt Name | Source |
|---|---|
| L-idarate | UniProt |