EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16O6 |
| Net Charge | 0 |
| Average Mass | 340.331 |
| Monoisotopic Mass | 340.09469 |
| SMILES | COc1cccc2c1-c1c(O)cc3c(c1C2=O)[C@@H](O)[C@@H]1O[C@]1(C)[C@@H]3O |
| InChI | InChI=1S/C19H16O6/c1-19-17(23)8-6-9(20)13-11-7(4-3-5-10(11)24-2)15(21)14(13)12(8)16(22)18(19)25-19/h3-6,16-18,20,22-23H,1-2H3/t16-,17-,18+,19-/m1/s1 |
| InChIKey | IWIWVHVOMWICKF-AKHDSKFASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (29522466) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fluostatin Q (CHEBI:213308) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| (3R,4S,6R,7R)-3,7,10-trihydroxy-13-methoxy-6-methyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,17]octadeca-1,8,10,12(17),13,15-hexaen-18-one |
| Manual Xrefs | Databases |
|---|---|
| 65321337 | ChemSpider |